C31H19N2O2+ — CID 44654323
7-benzoyl-2-aza-13-azoniaheptacyclo[16.5.2.14,8.02,13.015,24.021,25.012,26]hexacosa-1(23),4(26),5,7,9,11,13,15(24),16,18(25),21-undecaen-3-one (PubChem CID 44654323) has the molecular formula C31H19N2O2+ and a molecular weight of 451.51 g/mol. Its IUPAC name is 7-benzoyl-2-aza-13-azoniaheptacyclo[16.5.2.14,8.02,13.015,24.021,25.012,26]hexacosa-1(23),4(26),5,7,9,11,13,15(24),16,18(25),21-undecaen-3-one.
| Compound Name | 7-benzoyl-2-aza-13-azoniaheptacyclo[16.5.2.14,8.02,13.015,24.021,25.012,26]hexacosa-1(23),4(26),5,7,9,11,13,15(24),16,18(25),21-undecaen-3-one |
|---|---|
| PubChem CID | 44654323 |
| Molecular Formula | C31H19N2O2+ |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 7-benzoyl-2-aza-13-azoniaheptacyclo[16.5.2.14,8.02,13.015,24.021,25.012,26]hexacosa-1(23),4(26),5,7,9,11,13,15(24),16,18(25),21-undecaen-3-one |
| SMILES | O=C(c1ccccc1)c1ccc2c(=O)n3c4ccc5c6c(ccc(c[n+]3c3cccc1c23)c64)CC5 |
| InChI | InChI=1S/C31H19N2O2/c34-30(20-5-2-1-3-6-20)23-14-15-24-29-22(23)7-4-8-25(29)32-17-21-12-11-18-9-10-19-13-16-26(28(21)27(18)19)33(32)31(24)35/h1-8,11-17H,9-10H2/q+1 |
| InChIKey | SBXKPIMLBLIWRO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|