C18H16Cl2FNO8 — CID 102012143
[(2R,3S,4R,5R,6S)-4-acetyloxy-5-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-fluoro-3-hydroxyoxan-2-yl]methyl acetate (PubChem CID 102012143) has the molecular formula C18H16Cl2FNO8 and a molecular weight of 464.23 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-4-acetyloxy-5-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-fluoro-3-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-4-acetyloxy-5-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-fluoro-3-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102012143 |
| Molecular Formula | C18H16Cl2FNO8 |
| Molecular Weight | 464.23 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-4-acetyloxy-5-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-fluoro-3-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](F)[C@H](N2C(=O)c3cc(Cl)c(Cl)cc3C2=O)[C@@H](OC(C)=O)[C@@H]1O |
| InChI | InChI=1S/C18H16Cl2FNO8/c1-6(23)28-5-12-14(25)15(29-7(2)24)13(16(21)30-12)22-17(26)8-3-10(19)11(20)4-9(8)18(22)27/h3-4,12-16,25H,5H2,1-2H3/t12-,13-,14-,15-,16-/m1/s1 |
| InChIKey | DVEAKACKCJVDQC-OXGONZEZSA-N |
| XLogP | 1.51 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|