C23H21Cl4NO9 — CID 85202240
[3,4-diacetyloxy-6-prop-2-enyl-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate (PubChem CID 85202240) has the molecular formula C23H21Cl4NO9 and a molecular weight of 597.23 g/mol. Its IUPAC name is [3,4-diacetyloxy-6-prop-2-enyl-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-6-prop-2-enyl-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 85202240 |
| Molecular Formula | C23H21Cl4NO9 |
| Molecular Weight | 597.23 g/mol |
| Exact Mass | 595.00 |
| IUPAC Name | [3,4-diacetyloxy-6-prop-2-enyl-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
| SMILES | C=CCC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C23H21Cl4NO9/c1-5-6-11-19(28-22(32)13-14(23(28)33)16(25)18(27)17(26)15(13)24)21(36-10(4)31)20(35-9(3)30)12(37-11)7-34-8(2)29/h5,11-12,19-21H,1,6-7H2,2-4H3 |
| InChIKey | VEABMIBBTWDOEV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.23 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|