C14H18N2O2 — CID 102012985
(E)-3,10-dihydroxy-2,11-dimethylidenedodec-6-enedinitrile (PubChem CID 102012985) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (E)-3,10-dihydroxy-2,11-dimethylidenedodec-6-enedinitrile.
| Compound Name | (E)-3,10-dihydroxy-2,11-dimethylidenedodec-6-enedinitrile |
|---|---|
| PubChem CID | 102012985 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (E)-3,10-dihydroxy-2,11-dimethylidenedodec-6-enedinitrile |
| SMILES | C=C(C#N)C(O)CC/C=C/CCC(O)C(=C)C#N |
| InChI | InChI=1S/C14H18N2O2/c1-11(9-15)13(17)7-5-3-4-6-8-14(18)12(2)10-16/h3-4,13-14,17-18H,1-2,5-8H2/b4-3+ |
| InChIKey | BCKDBTOLSVHVRK-ONEGZZNKSA-N |
| XLogP | 1.98 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|