C12H22O5 — CID 173295773
6-(6,6-dihydroxyhex-2-enoxy)hex-4-ene-1,1-diol (PubChem CID 173295773) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is 6-(6,6-dihydroxyhex-2-enoxy)hex-4-ene-1,1-diol.
| Compound Name | 6-(6,6-dihydroxyhex-2-enoxy)hex-4-ene-1,1-diol |
|---|---|
| PubChem CID | 173295773 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 6-(6,6-dihydroxyhex-2-enoxy)hex-4-ene-1,1-diol |
| SMILES | OC(O)CCC=CCOCC=CCCC(O)O |
| InChI | InChI=1S/C12H22O5/c13-11(14)7-3-1-5-9-17-10-6-2-4-8-12(15)16/h1-2,5-6,11-16H,3-4,7-10H2 |
| InChIKey | ZLYSLVALLNQALU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|