C37H70N2O3 — CID 156805412
(2Z,5Z,24Z,27Z)-1,29-bis[2-(dimethylamino)ethoxy]nonacosa-2,5,24,27-tetraen-15-ol (PubChem CID 156805412) has the molecular formula C37H70N2O3 and a molecular weight of 590.98 g/mol. Its IUPAC name is (2Z,5Z,24Z,27Z)-1,29-bis[2-(dimethylamino)ethoxy]nonacosa-2,5,24,27-tetraen-15-ol.
| Compound Name | (2Z,5Z,24Z,27Z)-1,29-bis[2-(dimethylamino)ethoxy]nonacosa-2,5,24,27-tetraen-15-ol |
|---|---|
| PubChem CID | 156805412 |
| Molecular Formula | C37H70N2O3 |
| Molecular Weight | 590.98 g/mol |
| Exact Mass | 590.54 |
| IUPAC Name | (2Z,5Z,24Z,27Z)-1,29-bis[2-(dimethylamino)ethoxy]nonacosa-2,5,24,27-tetraen-15-ol |
| SMILES | CN(C)CCOC/C=C\C/C=C\CCCCCCCCC(O)CCCCCCCC/C=C\C/C=C\COCCN(C)C |
| InChI | InChI=1S/C37H70N2O3/c1-38(2)31-35-41-33-27-23-19-15-11-7-5-9-13-17-21-25-29-37(40)30-26-22-18-14-10-6-8-12-16-20-24-28-34-42-36-32-39(3)4/h11-12,15-16,23-24,27-28,37,40H,5-10,13-14,17-22,25-26,29-36H2,1-4H3/b15-11-,16-12-,27-23-,28-24- |
| InChIKey | CDZKWJBQCRAINR-QZUPHNDMSA-N |
| XLogP | 8.75 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.98 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|