C21H19N3O6S2 — CID 102015752
[2-[(4-sulfamoylphenyl)iminomethyl]phenyl] N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 102015752) has the molecular formula C21H19N3O6S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is [2-[(4-sulfamoylphenyl)iminomethyl]phenyl] N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | [2-[(4-sulfamoylphenyl)iminomethyl]phenyl] N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 102015752 |
| Molecular Formula | C21H19N3O6S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | [2-[(4-sulfamoylphenyl)iminomethyl]phenyl] N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Oc2ccccc2/C=N/c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H19N3O6S2/c1-15-6-10-19(11-7-15)32(28,29)24-21(25)30-20-5-3-2-4-16(20)14-23-17-8-12-18(13-9-17)31(22,26)27/h2-14H,1H3,(H,24,25)(H2,22,26,27)/b23-14+ |
| InChIKey | BFBCZHMEPLUPSW-OEAKJJBVSA-N |
| XLogP | 2.87 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|