C25H36N2O3 — CID 10201768
(2,6-ditert-butylcyclohexyl) 2-[(5-phenyl-1,3-oxazol-2-yl)amino]acetate (PubChem CID 10201768) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is (2,6-ditert-butylcyclohexyl) 2-[(5-phenyl-1,3-oxazol-2-yl)amino]acetate.
| Compound Name | (2,6-ditert-butylcyclohexyl) 2-[(5-phenyl-1,3-oxazol-2-yl)amino]acetate |
|---|---|
| PubChem CID | 10201768 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | (2,6-ditert-butylcyclohexyl) 2-[(5-phenyl-1,3-oxazol-2-yl)amino]acetate |
| SMILES | CC(C)(C)C1CCCC(C(C)(C)C)C1OC(=O)CNc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C25H36N2O3/c1-24(2,3)18-13-10-14-19(25(4,5)6)22(18)30-21(28)16-27-23-26-15-20(29-23)17-11-8-7-9-12-17/h7-9,11-12,15,18-19,22H,10,13-14,16H2,1-6H3,(H,26,27) |
| InChIKey | DSOAQLYSQVJSAL-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |