C29H36ClNO3SSi2 — CID 102018343
(2S,3R,4S)-3-[benzhydryl(dimethyl)silyl]-2-[[dimethyl(phenyl)silyl]methyl]-4-methyl-5-oxopyrrolidine-1-sulfonyl chloride (PubChem CID 102018343) has the molecular formula C29H36ClNO3SSi2 and a molecular weight of 570.30 g/mol. Its IUPAC name is (2S,3R,4S)-3-[benzhydryl(dimethyl)silyl]-2-[[dimethyl(phenyl)silyl]methyl]-4-methyl-5-oxopyrrolidine-1-sulfonyl chloride.
| Compound Name | (2S,3R,4S)-3-[benzhydryl(dimethyl)silyl]-2-[[dimethyl(phenyl)silyl]methyl]-4-methyl-5-oxopyrrolidine-1-sulfonyl chloride |
|---|---|
| PubChem CID | 102018343 |
| Molecular Formula | C29H36ClNO3SSi2 |
| Molecular Weight | 570.30 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | (2S,3R,4S)-3-[benzhydryl(dimethyl)silyl]-2-[[dimethyl(phenyl)silyl]methyl]-4-methyl-5-oxopyrrolidine-1-sulfonyl chloride |
| SMILES | C[C@H]1C(=O)N(S(=O)(=O)Cl)[C@@H](C[Si](C)(C)c2ccccc2)[C@@H]1[Si](C)(C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H36ClNO3SSi2/c1-22-27(37(4,5)28(23-15-9-6-10-16-23)24-17-11-7-12-18-24)26(31(29(22)32)35(30,33)34)21-36(2,3)25-19-13-8-14-20-25/h6-20,22,26-28H,21H2,1-5H3/t22-,26+,27-/m1/s1 |
| InChIKey | PDZBCRBJVZGXIE-VYCLJVNGSA-N |
| XLogP | 6.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.30 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|