C14H20ClNO3SSi — CID 10712565
(2R,3S,4R)-3-[dimethyl(phenyl)silyl]-2,4-dimethyl-5-oxopyrrolidine-1-sulfonyl chloride (PubChem CID 10712565) has the molecular formula C14H20ClNO3SSi and a molecular weight of 345.92 g/mol. Its IUPAC name is (2R,3S,4R)-3-[dimethyl(phenyl)silyl]-2,4-dimethyl-5-oxopyrrolidine-1-sulfonyl chloride.
| Compound Name | (2R,3S,4R)-3-[dimethyl(phenyl)silyl]-2,4-dimethyl-5-oxopyrrolidine-1-sulfonyl chloride |
|---|---|
| PubChem CID | 10712565 |
| Molecular Formula | C14H20ClNO3SSi |
| Molecular Weight | 345.92 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | (2R,3S,4R)-3-[dimethyl(phenyl)silyl]-2,4-dimethyl-5-oxopyrrolidine-1-sulfonyl chloride |
| SMILES | C[C@@H]1C(=O)N(S(=O)(=O)Cl)[C@H](C)[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C14H20ClNO3SSi/c1-10-13(11(2)16(14(10)17)20(15,18)19)21(3,4)12-8-6-5-7-9-12/h5-11,13H,1-4H3/t10-,11+,13-/m0/s1 |
| InChIKey | AQKLIAMYMRDTOY-LOWVWBTDSA-N |
| XLogP | 2.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.92 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|