C12H12O4 — CID 102018789
(1'R,2'R,3'R,5'R,7'S,8'S)-spiro[1,3-dioxolane-2,11'-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-ene]-6'-one (PubChem CID 102018789) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is (1'R,2'R,3'R,5'R,7'S,8'S)-spiro[1,3-dioxolane-2,11'-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-ene]-6'-one.
| Compound Name | (1'R,2'R,3'R,5'R,7'S,8'S)-spiro[1,3-dioxolane-2,11'-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-ene]-6'-one |
|---|---|
| PubChem CID | 102018789 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (1'R,2'R,3'R,5'R,7'S,8'S)-spiro[1,3-dioxolane-2,11'-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-ene]-6'-one |
| SMILES | O=C1[C@H]2[C@@H]([C@H]3O[C@@H]13)[C@H]1C=C[C@@H]2C12OCCO2 |
| InChI | InChI=1S/C12H12O4/c13-9-7-5-1-2-6(8(7)10-11(9)16-10)12(5)14-3-4-15-12/h1-2,5-8,10-11H,3-4H2/t5-,6+,7+,8-,10+,11-/m0/s1 |
| InChIKey | PGTJQDPPHXHNIC-YVSOORSISA-N |
| XLogP | 0.13 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|