C20H18O6 — CID 125035343
2-[(1'R,2'S,3'R,6'S,7'R)-spiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-yl]oxycarbonylbenzoic acid (PubChem CID 125035343) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-[(1'R,2'S,3'R,6'S,7'R)-spiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-yl]oxycarbonylbenzoic acid.
| Compound Name | 2-[(1'R,2'S,3'R,6'S,7'R)-spiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-yl]oxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 125035343 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-[(1'R,2'S,3'R,6'S,7'R)-spiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-yl]oxycarbonylbenzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)O[C@@H]1C=C[C@H]2[C@H]1[C@H]1C=C[C@H]2C12OCCO2 |
| InChI | InChI=1S/C20H18O6/c21-18(22)11-3-1-2-4-12(11)19(23)26-16-8-5-13-14-6-7-15(17(13)16)20(14)24-9-10-25-20/h1-8,13-17H,9-10H2,(H,21,22)/t13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | PAMWCEZKTZZXGF-HHARLNAUSA-N |
| XLogP | 2.27 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|