C15H20O6 — CID 102019719
[(1R,2S,7R,9S,14S,15S)-4,4-dimethyl-3,5,8,10-tetraoxatetracyclo[7.5.1.02,7.012,15]pentadec-12-en-14-yl] acetate (PubChem CID 102019719) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is [(1R,2S,7R,9S,14S,15S)-4,4-dimethyl-3,5,8,10-tetraoxatetracyclo[7.5.1.02,7.012,15]pentadec-12-en-14-yl] acetate.
| Compound Name | [(1R,2S,7R,9S,14S,15S)-4,4-dimethyl-3,5,8,10-tetraoxatetracyclo[7.5.1.02,7.012,15]pentadec-12-en-14-yl] acetate |
|---|---|
| PubChem CID | 102019719 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [(1R,2S,7R,9S,14S,15S)-4,4-dimethyl-3,5,8,10-tetraoxatetracyclo[7.5.1.02,7.012,15]pentadec-12-en-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C2CO[C@H]3O[C@@H]4COC(C)(C)O[C@H]4[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C15H20O6/c1-7(16)19-9-4-8-5-17-14-11(8)12(9)13-10(20-14)6-18-15(2,3)21-13/h4,9-14H,5-6H2,1-3H3/t9-,10+,11+,12-,13+,14-/m0/s1 |
| InChIKey | PTEDPKWLIYOOTO-OKDXSUHISA-N |
| XLogP | 1.00 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|