C31H36ClN5O8 — CID 102023325
tributyl 4-(5-amino-4-methoxycarbonylpyrazol-1-yl)-8-chloropyrrolo[1,2-a]quinoxaline-1,2,3-tricarboxylate (PubChem CID 102023325) has the molecular formula C31H36ClN5O8 and a molecular weight of 642.11 g/mol. Its IUPAC name is tributyl 4-(5-amino-4-methoxycarbonylpyrazol-1-yl)-8-chloropyrrolo[1,2-a]quinoxaline-1,2,3-tricarboxylate.
| Compound Name | tributyl 4-(5-amino-4-methoxycarbonylpyrazol-1-yl)-8-chloropyrrolo[1,2-a]quinoxaline-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 102023325 |
| Molecular Formula | C31H36ClN5O8 |
| Molecular Weight | 642.11 g/mol |
| Exact Mass | 641.23 |
| IUPAC Name | tributyl 4-(5-amino-4-methoxycarbonylpyrazol-1-yl)-8-chloropyrrolo[1,2-a]quinoxaline-1,2,3-tricarboxylate |
| SMILES | CCCCOC(=O)c1c(C(=O)OCCCC)c2c(-n3ncc(C(=O)OC)c3N)nc3ccc(Cl)cc3n2c1C(=O)OCCCC |
| InChI | InChI=1S/C31H36ClN5O8/c1-5-8-13-43-29(39)22-23(30(40)44-14-9-6-2)25(31(41)45-15-10-7-3)36-21-16-18(32)11-12-20(21)35-27(24(22)36)37-26(33)19(17-34-37)28(38)42-4/h11-12,16-17H,5-10,13-15,33H2,1-4H3 |
| InChIKey | JDCAWOSNQANIRN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 166.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.11 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|