C23H29N3O2 — CID 102024082
(6aR,10aR)-3-(6-azidohex-2-ynyl)-1-methoxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene (PubChem CID 102024082) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is (6aR,10aR)-3-(6-azidohex-2-ynyl)-1-methoxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene.
| Compound Name | (6aR,10aR)-3-(6-azidohex-2-ynyl)-1-methoxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 102024082 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (6aR,10aR)-3-(6-azidohex-2-ynyl)-1-methoxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene |
| SMILES | COc1cc(CC#CCCCN=[N+]=[N-])cc2c1[C@@H]1CC(C)=CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C23H29N3O2/c1-16-10-11-19-18(13-16)22-20(27-4)14-17(15-21(22)28-23(19,2)3)9-7-5-6-8-12-25-26-24/h10,14-15,18-19H,6,8-9,11-13H2,1-4H3/t18-,19-/m1/s1 |
| InChIKey | SONHFMLUUBKAMP-RTBURBONSA-N |
| XLogP | 5.94 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|