C20H22O3 — CID 102030081
(2S,5S)-2-(1-phenylethenoxy)-5-phenylmethoxyoxane (PubChem CID 102030081) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (2S,5S)-2-(1-phenylethenoxy)-5-phenylmethoxyoxane.
| Compound Name | (2S,5S)-2-(1-phenylethenoxy)-5-phenylmethoxyoxane |
|---|---|
| PubChem CID | 102030081 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (2S,5S)-2-(1-phenylethenoxy)-5-phenylmethoxyoxane |
| SMILES | C=C(O[C@H]1CC[C@H](OCc2ccccc2)CO1)c1ccccc1 |
| InChI | InChI=1S/C20H22O3/c1-16(18-10-6-3-7-11-18)23-20-13-12-19(15-22-20)21-14-17-8-4-2-5-9-17/h2-11,19-20H,1,12-15H2/t19-,20-/m0/s1 |
| InChIKey | SKRLNLBFZDEXTN-PMACEKPBSA-N |
| XLogP | 4.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|