C19H37NO — CID 102032386
(2R,6R,10R,11S)-11-butyl-2-pentyl-1-azaspiro[5.5]undecan-10-ol (PubChem CID 102032386) has the molecular formula C19H37NO and a molecular weight of 295.51 g/mol. Its IUPAC name is (2R,6R,10R,11S)-11-butyl-2-pentyl-1-azaspiro[5.5]undecan-10-ol.
| Compound Name | (2R,6R,10R,11S)-11-butyl-2-pentyl-1-azaspiro[5.5]undecan-10-ol |
|---|---|
| PubChem CID | 102032386 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | (2R,6R,10R,11S)-11-butyl-2-pentyl-1-azaspiro[5.5]undecan-10-ol |
| SMILES | CCCCC[C@@H]1CCC[C@]2(CCC[C@@H](O)[C@H]2CCCC)N1 |
| InChI | InChI=1S/C19H37NO/c1-3-5-7-10-16-11-8-14-19(20-16)15-9-13-18(21)17(19)12-6-4-2/h16-18,20-21H,3-15H2,1-2H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | BTKHRQIWTGOESJ-NCXUSEDFSA-N |
| XLogP | 4.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|