About 5-butylnonan-5-yl N-anilinocarbamate
5-butylnonan-5-yl N-anilinocarbamate (PubChem CID 102032688) has the molecular formula C20H34N2O2
and a molecular weight of 334.50 g/mol. Its IUPAC name is 5-butylnonan-5-yl N-anilinocarbamate.
Molecular Properties
| Compound Name | 5-butylnonan-5-yl N-anilinocarbamate |
| PubChem CID | 102032688 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | 5-butylnonan-5-yl N-anilinocarbamate |
| SMILES | CCCCC(CCCC)(CCCC)OC(=O)NNc1ccccc1 |
| InChI | InChI=1S/C20H34N2O2/c1-4-7-15-20(16-8-5-2,17-9-6-3)24-19(23)22-21-18-13-11-10-12-14-18/h10-14,21H,4-9,15-17H2,1-3H3,(H,22,23) |
| InChIKey | WFDLCUDPVOOALL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-butylnonan-5-yl N-anilinocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylnonan-5-yl N-anilinocarbamate?
The IUPAC name of 5-butylnonan-5-yl N-anilinocarbamate (CID 102032688) is 5-butylnonan-5-yl N-anilinocarbamate.
What is the SMILES notation for 5-butylnonan-5-yl N-anilinocarbamate?
The canonical SMILES for 5-butylnonan-5-yl N-anilinocarbamate is CCCCC(CCCC)(CCCC)OC(=O)NNc1ccccc1.
What is the InChIKey of 5-butylnonan-5-yl N-anilinocarbamate?
The InChIKey is WFDLCUDPVOOALL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N2O2/c1-4-7-15-20(16-8-5-2,17-9-6-3)24-19(23)22-21-18-13-11-10-12-14-18/h10-14,21H,4-9,15-17H2,1-3H3,(H,22,23).
What are the key properties of 5-butylnonan-5-yl N-anilinocarbamate?
5-butylnonan-5-yl N-anilinocarbamate has a molecular weight of 334.50 g/mol, XLogP of 6.05, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylnonan-5-yl N-anilinocarbamate is sourced from PubChem (CID 102032688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).