C27H20N8O — CID 102033374
(12Z)-11-methyl-3,5-diphenyl-12-(phenylhydrazinylidene)-4,5,7,9,10,14-hexazatricyclo[7.5.0.02,6]tetradeca-1(14),2(6),3,7,10-pentaen-13-one (PubChem CID 102033374) has the molecular formula C27H20N8O and a molecular weight of 472.51 g/mol. Its IUPAC name is (12Z)-11-methyl-3,5-diphenyl-12-(phenylhydrazinylidene)-4,5,7,9,10,14-hexazatricyclo[7.5.0.02,6]tetradeca-1(14),2(6),3,7,10-pentaen-13-one.
| Compound Name | (12Z)-11-methyl-3,5-diphenyl-12-(phenylhydrazinylidene)-4,5,7,9,10,14-hexazatricyclo[7.5.0.02,6]tetradeca-1(14),2(6),3,7,10-pentaen-13-one |
|---|---|
| PubChem CID | 102033374 |
| Molecular Formula | C27H20N8O |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | (12Z)-11-methyl-3,5-diphenyl-12-(phenylhydrazinylidene)-4,5,7,9,10,14-hexazatricyclo[7.5.0.02,6]tetradeca-1(14),2(6),3,7,10-pentaen-13-one |
| SMILES | Cc1nn2cnc3c(c(-c4ccccc4)nn3-c3ccccc3)c2nc(=O)/c1=N\Nc1ccccc1 |
| InChI | InChI=1S/C27H20N8O/c1-18-23(31-30-20-13-7-3-8-14-20)27(36)29-26-22-24(19-11-5-2-6-12-19)33-35(21-15-9-4-10-16-21)25(22)28-17-34(26)32-18/h2-17,30H,1H3/b31-23- |
| InChIKey | WVSUEBDEKFOHNS-SXBRIOAWSA-N |
| XLogP | 3.73 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|