C28H42N10O5 — CID 102035715
5-N-[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]-3-phenylpropanoyl]-2-N-(diaminomethylidene)-1H-pyrrole-2,5-dicarboxamide (PubChem CID 102035715) has the molecular formula C28H42N10O5 and a molecular weight of 598.71 g/mol. Its IUPAC name is 5-N-[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]-3-phenylpropanoyl]-2-N-(diaminomethylidene)-1H-pyrrole-2,5-dicarboxamide.
| Compound Name | 5-N-[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]-3-phenylpropanoyl]-2-N-(diaminomethylidene)-1H-pyrrole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 102035715 |
| Molecular Formula | C28H42N10O5 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 5-N-[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]-3-phenylpropanoyl]-2-N-(diaminomethylidene)-1H-pyrrole-2,5-dicarboxamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)NC(=O)c1ccc(C(=O)N=C(N)N)[nH]1 |
| InChI | InChI=1S/C28H42N10O5/c29-14-6-4-10-18(31)23(39)35-19(11-5-7-15-30)24(40)36-22(16-17-8-2-1-3-9-17)27(43)37-25(41)20-12-13-21(34-20)26(42)38-28(32)33/h1-3,8-9,12-13,18-19,22,34H,4-7,10-11,14-16,29-31H2,(H,35,39)(H,36,40)(H,37,41,43)(H4,32,33,38,42)/t18-,19-,22-/m0/s1 |
| InChIKey | WLCDEOVEIBZCRZ-IPJJNNNSSA-N |
| XLogP | -1.52 |
| TPSA | 279.69 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|