C11H12ClN — CID 102036798
5-(2-chlorophenyl)-1-methyl-2,3-dihydropyrrole (PubChem CID 102036798) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-1-methyl-2,3-dihydropyrrole.
| Compound Name | 5-(2-chlorophenyl)-1-methyl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 102036798 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 5-(2-chlorophenyl)-1-methyl-2,3-dihydropyrrole |
| SMILES | CN1CCC=C1c1ccccc1Cl |
| InChI | InChI=1S/C11H12ClN/c1-13-8-4-7-11(13)9-5-2-3-6-10(9)12/h2-3,5-7H,4,8H2,1H3 |
| InChIKey | PIBKAJFOAGBTTA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |