C9H9ClN2S — CID 141152066
5-(2-chlorophenyl)-3-methyl-2H-1,3,4-thiadiazole (PubChem CID 141152066) has the molecular formula C9H9ClN2S and a molecular weight of 212.71 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-methyl-2H-1,3,4-thiadiazole.
| Compound Name | 5-(2-chlorophenyl)-3-methyl-2H-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 141152066 |
| Molecular Formula | C9H9ClN2S |
| Molecular Weight | 212.71 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 5-(2-chlorophenyl)-3-methyl-2H-1,3,4-thiadiazole |
| SMILES | CN1CSC(c2ccccc2Cl)=N1 |
| InChI | InChI=1S/C9H9ClN2S/c1-12-6-13-9(11-12)7-4-2-3-5-8(7)10/h2-5H,6H2,1H3 |
| InChIKey | OBFCCEUPHWBIFY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.71 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |