C16H12Cl2Se — CID 134982285
3,4-bis(2-chlorophenyl)-2,5-dihydroselenophene (PubChem CID 134982285) has the molecular formula C16H12Cl2Se and a molecular weight of 354.14 g/mol. Its IUPAC name is 3,4-bis(2-chlorophenyl)-2,5-dihydroselenophene.
| Compound Name | 3,4-bis(2-chlorophenyl)-2,5-dihydroselenophene |
|---|---|
| PubChem CID | 134982285 |
| Molecular Formula | C16H12Cl2Se |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 3,4-bis(2-chlorophenyl)-2,5-dihydroselenophene |
| SMILES | Clc1ccccc1C1=C(c2ccccc2Cl)C[Se]C1 |
| InChI | InChI=1S/C16H12Cl2Se/c17-15-7-3-1-5-11(15)13-9-19-10-14(13)12-6-2-4-8-16(12)18/h1-8H,9-10H2 |
| InChIKey | WSQVTUVYAXEWCQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|