About 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene
1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene (PubChem CID 102039012) has the molecular formula C9H6Cl2N2O
and a molecular weight of 229.07 g/mol. Its IUPAC name is 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene.
Molecular Properties
| Compound Name | 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene |
| PubChem CID | 102039012 |
| Molecular Formula | C9H6Cl2N2O |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene |
| SMILES | [N-]=[N+]=Cc1ccccc1O/C(Cl)=C\Cl |
| InChI | InChI=1S/C9H6Cl2N2O/c10-5-9(11)14-8-4-2-1-3-7(8)6-13-12/h1-6H/b9-5- |
| InChIKey | SWXRKPHPPZYKKW-UITAMQMPSA-N |
| XLogP | 2.99 |
| TPSA | 45.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene?
The IUPAC name of 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene (CID 102039012) is 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene.
What is the SMILES notation for 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene?
The canonical SMILES for 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene is [N-]=[N+]=Cc1ccccc1O/C(Cl)=C\Cl.
What is the InChIKey of 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene?
The InChIKey is SWXRKPHPPZYKKW-UITAMQMPSA-N. The full InChI is InChI=1S/C9H6Cl2N2O/c10-5-9(11)14-8-4-2-1-3-7(8)6-13-12/h1-6H/b9-5-.
What are the key properties of 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene?
1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene has a molecular weight of 229.07 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diazomethyl)-2-[(E)-1,2-dichloroethenoxy]benzene is sourced from PubChem (CID 102039012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).