C12H14F3NO — CID 102040624
N-[(1R)-1-phenylethyl]-N-(1,1,1-trifluorobut-3-en-2-yl)hydroxylamine (PubChem CID 102040624) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-N-(1,1,1-trifluorobut-3-en-2-yl)hydroxylamine.
| Compound Name | N-[(1R)-1-phenylethyl]-N-(1,1,1-trifluorobut-3-en-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 102040624 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-N-(1,1,1-trifluorobut-3-en-2-yl)hydroxylamine |
| SMILES | C=CC(N(O)[C@H](C)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO/c1-3-11(12(13,14)15)16(17)9(2)10-7-5-4-6-8-10/h3-9,11,17H,1H2,2H3/t9-,11?/m1/s1 |
| InChIKey | XQUYDSGAIULZRB-BFHBGLAWSA-N |
| XLogP | 3.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|