C14H18F3NO — CID 11747720
(1R,2S)-1-phenyl-2-(1,1,1-trifluoropent-4-en-2-ylamino)propan-1-ol (PubChem CID 11747720) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is (1R,2S)-1-phenyl-2-(1,1,1-trifluoropent-4-en-2-ylamino)propan-1-ol.
| Compound Name | (1R,2S)-1-phenyl-2-(1,1,1-trifluoropent-4-en-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 11747720 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (1R,2S)-1-phenyl-2-(1,1,1-trifluoropent-4-en-2-ylamino)propan-1-ol |
| SMILES | C=CCC(N[C@@H](C)[C@H](O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO/c1-3-7-12(14(15,16)17)18-10(2)13(19)11-8-5-4-6-9-11/h3-6,8-10,12-13,18-19H,1,7H2,2H3/t10-,12?,13-/m0/s1 |
| InChIKey | FFGYLPSFJSHPKA-VLIRHVTKSA-N |
| XLogP | 3.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|