C21H33N3Si — CID 102041860
1,3-dicyclohexyl-2,2-dimethyl-N-phenyl-1,3,2-diazasiletidin-4-imine (PubChem CID 102041860) has the molecular formula C21H33N3Si and a molecular weight of 355.60 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2,2-dimethyl-N-phenyl-1,3,2-diazasiletidin-4-imine.
| Compound Name | 1,3-dicyclohexyl-2,2-dimethyl-N-phenyl-1,3,2-diazasiletidin-4-imine |
|---|---|
| PubChem CID | 102041860 |
| Molecular Formula | C21H33N3Si |
| Molecular Weight | 355.60 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 1,3-dicyclohexyl-2,2-dimethyl-N-phenyl-1,3,2-diazasiletidin-4-imine |
| SMILES | C[Si]1(C)N(C2CCCCC2)C(=Nc2ccccc2)N1C1CCCCC1 |
| InChI | InChI=1S/C21H33N3Si/c1-25(2)23(19-14-8-4-9-15-19)21(22-18-12-6-3-7-13-18)24(25)20-16-10-5-11-17-20/h3,6-7,12-13,19-20H,4-5,8-11,14-17H2,1-2H3 |
| InChIKey | FXPNWGIMLADCAF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|