C17H22N2S — CID 10565165
3-cyclohexyl-5-ethenyl-N-phenyl-1,3-thiazolidin-2-imine (PubChem CID 10565165) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 3-cyclohexyl-5-ethenyl-N-phenyl-1,3-thiazolidin-2-imine.
| Compound Name | 3-cyclohexyl-5-ethenyl-N-phenyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 10565165 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-cyclohexyl-5-ethenyl-N-phenyl-1,3-thiazolidin-2-imine |
| SMILES | C=CC1CN(C2CCCCC2)/C(=N/c2ccccc2)S1 |
| InChI | InChI=1S/C17H22N2S/c1-2-16-13-19(15-11-7-4-8-12-15)17(20-16)18-14-9-5-3-6-10-14/h2-3,5-6,9-10,15-16H,1,4,7-8,11-13H2/b18-17- |
| InChIKey | URFQFFRFXUXBKE-ZCXUNETKSA-N |
| XLogP | 4.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|