C22H46O4Si2 — CID 102045930
(2E,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methylocta-2,7-dien-1-ol (PubChem CID 102045930) has the molecular formula C22H46O4Si2 and a molecular weight of 430.78 g/mol. Its IUPAC name is (2E,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methylocta-2,7-dien-1-ol.
| Compound Name | (2E,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methylocta-2,7-dien-1-ol |
|---|---|
| PubChem CID | 102045930 |
| Molecular Formula | C22H46O4Si2 |
| Molecular Weight | 430.78 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (2E,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methylocta-2,7-dien-1-ol |
| SMILES | C=C[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C(\C)CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O4Si2/c1-14-18(24-9)20(26-28(12,13)22(6,7)8)19(15-17(2)16-23)25-27(10,11)21(3,4)5/h14-15,18-20,23H,1,16H2,2-13H3/b17-15+/t18-,19+,20+/m0/s1 |
| InChIKey | DSDLRCTZZFTYSI-OMUFDCOQSA-N |
| XLogP | 5.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.78 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|