C16H28O3Si — CID 102051874
methyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethenylidene]cyclopentyl]acetate (PubChem CID 102051874) has the molecular formula C16H28O3Si and a molecular weight of 296.48 g/mol. Its IUPAC name is methyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethenylidene]cyclopentyl]acetate.
| Compound Name | methyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethenylidene]cyclopentyl]acetate |
|---|---|
| PubChem CID | 102051874 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | methyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethenylidene]cyclopentyl]acetate |
| SMILES | COC(=O)CC1CCCC1=C=CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O3Si/c1-16(2,3)20(5,6)19-11-10-13-8-7-9-14(13)12-15(17)18-4/h11,14H,7-9,12H2,1-6H3 |
| InChIKey | OXVSCGXMWKTGDR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|