C17H18O5 — CID 102055999
(2S)-2-(3,4-dihydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromene-5,7-diol (PubChem CID 102055999) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2S)-2-(3,4-dihydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromene-5,7-diol.
| Compound Name | (2S)-2-(3,4-dihydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromene-5,7-diol |
|---|---|
| PubChem CID | 102055999 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (2S)-2-(3,4-dihydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromene-5,7-diol |
| SMILES | Cc1c(O)c(C)c2c(c1O)CC[C@@H](c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C17H18O5/c1-8-15(20)9(2)17-11(16(8)21)4-6-14(22-17)10-3-5-12(18)13(19)7-10/h3,5,7,14,18-21H,4,6H2,1-2H3/t14-/m0/s1 |
| InChIKey | HSHMNAZDBWPXCP-AWEZNQCLSA-N |
| XLogP | 3.19 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|