C30H26O10 — CID 142022323
(2R)-8-[(2S)-5,7-dihydroxy-2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromen-8-yl]-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 142022323) has the molecular formula C30H26O10 and a molecular weight of 546.53 g/mol. Its IUPAC name is (2R)-8-[(2S)-5,7-dihydroxy-2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromen-8-yl]-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | (2R)-8-[(2S)-5,7-dihydroxy-2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromen-8-yl]-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 142022323 |
| Molecular Formula | C30H26O10 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | (2R)-8-[(2S)-5,7-dihydroxy-2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromen-8-yl]-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | Oc1cccc([C@@H]2CCc3c(O)cc(O)c(-c4c(O)cc(O)c5c4O[C@H](c4ccc(O)c(O)c4)C(O)C5)c3O2)c1 |
| InChI | InChI=1S/C30H26O10/c31-15-3-1-2-13(8-15)25-7-5-16-19(33)11-22(36)26(29(16)39-25)27-23(37)12-20(34)17-10-24(38)28(40-30(17)27)14-4-6-18(32)21(35)9-14/h1-4,6,8-9,11-12,24-25,28,31-38H,5,7,10H2/t24?,25-,28+/m0/s1 |
| InChIKey | UFFNYEDJDCWISA-WYBMKQAMSA-N |
| XLogP | 4.40 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|