C12H21F3N2O — CID 102056443
(3Z)-3-[tert-butyl(methyl)hydrazinylidene]-1,1,1-trifluoro-5-methylhexan-2-one (PubChem CID 102056443) has the molecular formula C12H21F3N2O and a molecular weight of 266.31 g/mol. Its IUPAC name is (3Z)-3-[tert-butyl(methyl)hydrazinylidene]-1,1,1-trifluoro-5-methylhexan-2-one.
| Compound Name | (3Z)-3-[tert-butyl(methyl)hydrazinylidene]-1,1,1-trifluoro-5-methylhexan-2-one |
|---|---|
| PubChem CID | 102056443 |
| Molecular Formula | C12H21F3N2O |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (3Z)-3-[tert-butyl(methyl)hydrazinylidene]-1,1,1-trifluoro-5-methylhexan-2-one |
| SMILES | CC(C)C/C(=N/N(C)C(C)(C)C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O/c1-8(2)7-9(10(18)12(13,14)15)16-17(6)11(3,4)5/h8H,7H2,1-6H3/b16-9- |
| InChIKey | FIKUMVCORAVHRJ-SXGWCWSVSA-N |
| XLogP | 3.25 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|