C19H15ClN2O2 — CID 102058443
methyl 1-amino-6-chloro-4-cyano-4-phenyl-3H-naphthalene-2-carboxylate (PubChem CID 102058443) has the molecular formula C19H15ClN2O2 and a molecular weight of 338.79 g/mol. Its IUPAC name is methyl 1-amino-6-chloro-4-cyano-4-phenyl-3H-naphthalene-2-carboxylate.
| Compound Name | methyl 1-amino-6-chloro-4-cyano-4-phenyl-3H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 102058443 |
| Molecular Formula | C19H15ClN2O2 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | methyl 1-amino-6-chloro-4-cyano-4-phenyl-3H-naphthalene-2-carboxylate |
| SMILES | COC(=O)C1=C(N)c2ccc(Cl)cc2C(C#N)(c2ccccc2)C1 |
| InChI | InChI=1S/C19H15ClN2O2/c1-24-18(23)15-10-19(11-21,12-5-3-2-4-6-12)16-9-13(20)7-8-14(16)17(15)22/h2-9H,10,22H2,1H3 |
| InChIKey | LKZAHXSLJHLZJG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |