C18H12ClFN2O2 — CID 3699409
methyl 3-amino-1-(4-chlorophenyl)-1-cyano-4-fluoroindene-2-carboxylate (PubChem CID 3699409) has the molecular formula C18H12ClFN2O2 and a molecular weight of 342.76 g/mol. Its IUPAC name is methyl 3-amino-1-(4-chlorophenyl)-1-cyano-4-fluoroindene-2-carboxylate.
| Compound Name | methyl 3-amino-1-(4-chlorophenyl)-1-cyano-4-fluoroindene-2-carboxylate |
|---|---|
| PubChem CID | 3699409 |
| Molecular Formula | C18H12ClFN2O2 |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | methyl 3-amino-1-(4-chlorophenyl)-1-cyano-4-fluoroindene-2-carboxylate |
| SMILES | COC(=O)C1=C(N)c2c(F)cccc2C1(C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12ClFN2O2/c1-24-17(23)15-16(22)14-12(3-2-4-13(14)20)18(15,9-21)10-5-7-11(19)8-6-10/h2-8H,22H2,1H3 |
| InChIKey | QPGBABUYDJSDAL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |