C14H20O — CID 102062107
(6R,8S)-11-propan-2-ylidene-7-oxatetracyclo[6.3.1.02,6.04,10]dodecane (PubChem CID 102062107) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (6R,8S)-11-propan-2-ylidene-7-oxatetracyclo[6.3.1.02,6.04,10]dodecane.
| Compound Name | (6R,8S)-11-propan-2-ylidene-7-oxatetracyclo[6.3.1.02,6.04,10]dodecane |
|---|---|
| PubChem CID | 102062107 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (6R,8S)-11-propan-2-ylidene-7-oxatetracyclo[6.3.1.02,6.04,10]dodecane |
| SMILES | CC(C)=C1C2C[C@H]3CC1C1CC2C[C@H]1O3 |
| InChI | InChI=1S/C14H20O/c1-7(2)14-10-5-9-6-12(14)11-3-8(10)4-13(11)15-9/h8-13H,3-6H2,1-2H3/t8?,9-,10?,11?,12?,13+/m0/s1 |
| InChIKey | IUFQHDXPCBOVSL-UUYBFBTDSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|