C11H13O2- — CID 3338752
5-propan-2-ylidenetricyclo[4.1.0.02,4]heptane-3-carboxylate (PubChem CID 3338752) has the molecular formula C11H13O2- and a molecular weight of 177.22 g/mol. Its IUPAC name is 5-propan-2-ylidenetricyclo[4.1.0.02,4]heptane-3-carboxylate.
| Compound Name | 5-propan-2-ylidenetricyclo[4.1.0.02,4]heptane-3-carboxylate |
|---|---|
| PubChem CID | 3338752 |
| Molecular Formula | C11H13O2- |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 5-propan-2-ylidenetricyclo[4.1.0.02,4]heptane-3-carboxylate |
| SMILES | CC(C)=C1C2CC2C2C(C(=O)[O-])C12 |
| InChI | InChI=1S/C11H14O2/c1-4(2)7-5-3-6(5)8-9(7)10(8)11(12)13/h5-6,8-10H,3H2,1-2H3,(H,12,13)/p-1 |
| InChIKey | IDPHIODYRLZABH-UHFFFAOYSA-M |
| XLogP | 0.58 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|