C19H31NO3Si — CID 102062915
tert-butyl 6,6-dimethyl-4-oxo-3-(trimethylsilylmethyl)-5,7-dihydroindole-1-carboxylate (PubChem CID 102062915) has the molecular formula C19H31NO3Si and a molecular weight of 349.55 g/mol. Its IUPAC name is tert-butyl 6,6-dimethyl-4-oxo-3-(trimethylsilylmethyl)-5,7-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 6,6-dimethyl-4-oxo-3-(trimethylsilylmethyl)-5,7-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 102062915 |
| Molecular Formula | C19H31NO3Si |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | tert-butyl 6,6-dimethyl-4-oxo-3-(trimethylsilylmethyl)-5,7-dihydroindole-1-carboxylate |
| SMILES | CC1(C)CC(=O)c2c(C[Si](C)(C)C)cn(C(=O)OC(C)(C)C)c2C1 |
| InChI | InChI=1S/C19H31NO3Si/c1-18(2,3)23-17(22)20-11-13(12-24(6,7)8)16-14(20)9-19(4,5)10-15(16)21/h11H,9-10,12H2,1-8H3 |
| InChIKey | DUEBUMCSMUIFSX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|