C10H20S3 — CID 102064130
2,4-bis(1-methylsulfanylethyl)thiolane (PubChem CID 102064130) has the molecular formula C10H20S3 and a molecular weight of 236.47 g/mol. Its IUPAC name is 2,4-bis(1-methylsulfanylethyl)thiolane.
| Compound Name | 2,4-bis(1-methylsulfanylethyl)thiolane |
|---|---|
| PubChem CID | 102064130 |
| Molecular Formula | C10H20S3 |
| Molecular Weight | 236.47 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2,4-bis(1-methylsulfanylethyl)thiolane |
| SMILES | CSC(C)C1CSC(C(C)SC)C1 |
| InChI | InChI=1S/C10H20S3/c1-7(11-3)9-5-10(13-6-9)8(2)12-4/h7-10H,5-6H2,1-4H3 |
| InChIKey | QIGFTHGICVSJGE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |