C11H24PS3+ — CID 10365525
(5-tert-butyl-1,3-dithian-2-yl)-dimethyl-methylsulfanylphosphanium (PubChem CID 10365525) has the molecular formula C11H24PS3+ and a molecular weight of 283.49 g/mol. Its IUPAC name is (5-tert-butyl-1,3-dithian-2-yl)-dimethyl-methylsulfanylphosphanium.
| Compound Name | (5-tert-butyl-1,3-dithian-2-yl)-dimethyl-methylsulfanylphosphanium |
|---|---|
| PubChem CID | 10365525 |
| Molecular Formula | C11H24PS3+ |
| Molecular Weight | 283.49 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (5-tert-butyl-1,3-dithian-2-yl)-dimethyl-methylsulfanylphosphanium |
| SMILES | CS[P+](C)(C)C1SCC(C(C)(C)C)CS1 |
| InChI | InChI=1S/C11H24PS3/c1-11(2,3)9-7-14-10(15-8-9)12(4,5)13-6/h9-10H,7-8H2,1-6H3/q+1 |
| InChIKey | FPKUWDVJDGAMCU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|