About 2,4-ditert-butylthiane
2,4-ditert-butylthiane (PubChem CID 158872945) has the molecular formula C13H26S
and a molecular weight of 214.42 g/mol. Its IUPAC name is 2,4-ditert-butylthiane.
Molecular Properties
| Compound Name | 2,4-ditert-butylthiane |
| PubChem CID | 158872945 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2,4-ditert-butylthiane |
| SMILES | CC(C)(C)C1CCSC(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H26S/c1-12(2,3)10-7-8-14-11(9-10)13(4,5)6/h10-11H,7-9H2,1-6H3 |
| InChIKey | VSGYCMFCVXNTAR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-ditert-butylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butylthiane?
The IUPAC name of 2,4-ditert-butylthiane (CID 158872945) is 2,4-ditert-butylthiane.
What is the SMILES notation for 2,4-ditert-butylthiane?
The canonical SMILES for 2,4-ditert-butylthiane is CC(C)(C)C1CCSC(C(C)(C)C)C1.
What is the InChIKey of 2,4-ditert-butylthiane?
The InChIKey is VSGYCMFCVXNTAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26S/c1-12(2,3)10-7-8-14-11(9-10)13(4,5)6/h10-11H,7-9H2,1-6H3.
What are the key properties of 2,4-ditert-butylthiane?
2,4-ditert-butylthiane has a molecular weight of 214.42 g/mol, XLogP of 4.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butylthiane is sourced from PubChem (CID 158872945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).