C26H30ClPS2 — CID 10254249
(5-tert-butyl-1,3-dithian-2-yl)-triphenylphosphanium chloride (PubChem CID 10254249) has the molecular formula C26H30ClPS2 and a molecular weight of 473.09 g/mol. Its IUPAC name is (5-tert-butyl-1,3-dithian-2-yl)-triphenylphosphanium chloride.
| Compound Name | (5-tert-butyl-1,3-dithian-2-yl)-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 10254249 |
| Molecular Formula | C26H30ClPS2 |
| Molecular Weight | 473.09 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (5-tert-butyl-1,3-dithian-2-yl)-triphenylphosphanium chloride |
| SMILES | CC(C)(C)C1CSC([P+](c2ccccc2)(c2ccccc2)c2ccccc2)SC1.[Cl-] |
| InChI | InChI=1S/C26H30PS2.ClH/c1-26(2,3)21-19-28-25(29-20-21)27(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24;/h4-18,21,25H,19-20H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ODMNUECNEQIOFF-UHFFFAOYSA-M |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.09 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|