About tert-butylcyclohexane;scandium
tert-butylcyclohexane;scandium (PubChem CID 163823228) has the molecular formula C10H19Sc-
and a molecular weight of 184.22 g/mol. Its IUPAC name is tert-butylcyclohexane;scandium.
Molecular Properties
| Compound Name | tert-butylcyclohexane;scandium |
| PubChem CID | 163823228 |
| Molecular Formula | C10H19Sc- |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | tert-butylcyclohexane;scandium |
| SMILES | CC(C)(C)C1CC[CH-]CC1.[Sc] |
| InChI | InChI=1S/C10H19.Sc/c1-10(2,3)9-7-5-4-6-8-9;/h4,9H,5-8H2,1-3H3;/q-1; |
| InChIKey | JLGXPTVVXXQEDQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tert-butylcyclohexane;scandium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylcyclohexane;scandium?
The IUPAC name of tert-butylcyclohexane;scandium (CID 163823228) is tert-butylcyclohexane;scandium.
What is the SMILES notation for tert-butylcyclohexane;scandium?
The canonical SMILES for tert-butylcyclohexane;scandium is CC(C)(C)C1CC[CH-]CC1.[Sc].
What is the InChIKey of tert-butylcyclohexane;scandium?
The InChIKey is JLGXPTVVXXQEDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19.Sc/c1-10(2,3)9-7-5-4-6-8-9;/h4,9H,5-8H2,1-3H3;/q-1;.
What are the key properties of tert-butylcyclohexane;scandium?
tert-butylcyclohexane;scandium has a molecular weight of 184.22 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylcyclohexane;scandium is sourced from PubChem (CID 163823228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).