C30H44O4 — CID 102064462
[(2E,6E,10E)-3,7,11-trimethyl-14-prop-1-en-2-ylcyclotetradeca-2,6,10-trien-1-yl] 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 102064462) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is [(2E,6E,10E)-3,7,11-trimethyl-14-prop-1-en-2-ylcyclotetradeca-2,6,10-trien-1-yl] 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [(2E,6E,10E)-3,7,11-trimethyl-14-prop-1-en-2-ylcyclotetradeca-2,6,10-trien-1-yl] 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 102064462 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | [(2E,6E,10E)-3,7,11-trimethyl-14-prop-1-en-2-ylcyclotetradeca-2,6,10-trien-1-yl] 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | C=C(C)C1CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C1OC(=O)C12CCC(C)(C(=O)O1)C2(C)C |
| InChI | InChI=1S/C30H44O4/c1-20(2)24-16-15-22(4)13-9-11-21(3)12-10-14-23(5)19-25(24)33-27(32)30-18-17-29(8,26(31)34-30)28(30,6)7/h12-13,19,24-25H,1,9-11,14-18H2,2-8H3/b21-12+,22-13+,23-19+ |
| InChIKey | XPONBLPQQPCUGY-YISVINQMSA-N |
| XLogP | 7.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|