C9H17NO3SSi — CID 102067911
methyl (2R,3R)-2-thiocyanato-3-trimethylsilyloxybutanoate (PubChem CID 102067911) has the molecular formula C9H17NO3SSi and a molecular weight of 247.39 g/mol. Its IUPAC name is methyl (2R,3R)-2-thiocyanato-3-trimethylsilyloxybutanoate.
| Compound Name | methyl (2R,3R)-2-thiocyanato-3-trimethylsilyloxybutanoate |
|---|---|
| PubChem CID | 102067911 |
| Molecular Formula | C9H17NO3SSi |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | methyl (2R,3R)-2-thiocyanato-3-trimethylsilyloxybutanoate |
| SMILES | COC(=O)[C@H](SC#N)[C@@H](C)O[Si](C)(C)C |
| InChI | InChI=1S/C9H17NO3SSi/c1-7(13-15(3,4)5)8(14-6-10)9(11)12-2/h7-8H,1-5H3/t7-,8-/m1/s1 |
| InChIKey | BNAWJPCBUCVBDQ-HTQZYQBOSA-N |
| XLogP | 1.98 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|