C8H17N3O3Si — CID 11148952
methyl (2S,3R)-2-azido-3-trimethylsilyloxybutanoate (PubChem CID 11148952) has the molecular formula C8H17N3O3Si and a molecular weight of 231.33 g/mol. Its IUPAC name is methyl (2S,3R)-2-azido-3-trimethylsilyloxybutanoate.
| Compound Name | methyl (2S,3R)-2-azido-3-trimethylsilyloxybutanoate |
|---|---|
| PubChem CID | 11148952 |
| Molecular Formula | C8H17N3O3Si |
| Molecular Weight | 231.33 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | methyl (2S,3R)-2-azido-3-trimethylsilyloxybutanoate |
| SMILES | COC(=O)[C@@H](N=[N+]=[N-])[C@@H](C)O[Si](C)(C)C |
| InChI | InChI=1S/C8H17N3O3Si/c1-6(14-15(3,4)5)7(10-11-9)8(12)13-2/h6-7H,1-5H3/t6-,7+/m1/s1 |
| InChIKey | CEVJDFUNEMRPEH-RQJHMYQMSA-N |
| XLogP | 2.08 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|