C8H12N4O6 — CID 10753806
dimethyl (2S,3R)-2-azido-3-(methoxycarbonylamino)butanedioate (PubChem CID 10753806) has the molecular formula C8H12N4O6 and a molecular weight of 260.21 g/mol. Its IUPAC name is dimethyl (2S,3R)-2-azido-3-(methoxycarbonylamino)butanedioate.
| Compound Name | dimethyl (2S,3R)-2-azido-3-(methoxycarbonylamino)butanedioate |
|---|---|
| PubChem CID | 10753806 |
| Molecular Formula | C8H12N4O6 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | dimethyl (2S,3R)-2-azido-3-(methoxycarbonylamino)butanedioate |
| SMILES | COC(=O)N[C@@H](C(=O)OC)[C@H](N=[N+]=[N-])C(=O)OC |
| InChI | InChI=1S/C8H12N4O6/c1-16-6(13)4(10-8(15)18-3)5(11-12-9)7(14)17-2/h4-5H,1-3H3,(H,10,15)/t4-,5+/m1/s1 |
| InChIKey | YDKWIKISTBQRJZ-UHNVWZDZSA-N |
| XLogP | -0.26 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|