C18H32N2O5 — CID 102068731
(2R,3R)-2-hydroxy-3-[(E)-2-[(1S,2R)-2-hydroxy-2-propan-2-ylcyclopentyl]ethenoxy]-N,N,N',N'-tetramethylbutanediamide (PubChem CID 102068731) has the molecular formula C18H32N2O5 and a molecular weight of 356.46 g/mol. Its IUPAC name is (2R,3R)-2-hydroxy-3-[(E)-2-[(1S,2R)-2-hydroxy-2-propan-2-ylcyclopentyl]ethenoxy]-N,N,N',N'-tetramethylbutanediamide.
| Compound Name | (2R,3R)-2-hydroxy-3-[(E)-2-[(1S,2R)-2-hydroxy-2-propan-2-ylcyclopentyl]ethenoxy]-N,N,N',N'-tetramethylbutanediamide |
|---|---|
| PubChem CID | 102068731 |
| Molecular Formula | C18H32N2O5 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | (2R,3R)-2-hydroxy-3-[(E)-2-[(1S,2R)-2-hydroxy-2-propan-2-ylcyclopentyl]ethenoxy]-N,N,N',N'-tetramethylbutanediamide |
| SMILES | CC(C)[C@]1(O)CCC[C@H]1/C=C/O[C@@H](C(=O)N(C)C)[C@@H](O)C(=O)N(C)C |
| InChI | InChI=1S/C18H32N2O5/c1-12(2)18(24)10-7-8-13(18)9-11-25-15(17(23)20(5)6)14(21)16(22)19(3)4/h9,11-15,21,24H,7-8,10H2,1-6H3/b11-9+/t13-,14+,15+,18+/m0/s1 |
| InChIKey | CNVWXQTYAUKQTI-CJGCASAQSA-N |
| XLogP | 0.61 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|