C17H30N2O5 — CID 102068734
(2R,3R)-2-hydroxy-3-[(E)-2-[(1S,2S,4S)-2-hydroxy-2,4-dimethylcyclopentyl]ethenoxy]-N,N,N',N'-tetramethylbutanediamide (PubChem CID 102068734) has the molecular formula C17H30N2O5 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2R,3R)-2-hydroxy-3-[(E)-2-[(1S,2S,4S)-2-hydroxy-2,4-dimethylcyclopentyl]ethenoxy]-N,N,N',N'-tetramethylbutanediamide.
| Compound Name | (2R,3R)-2-hydroxy-3-[(E)-2-[(1S,2S,4S)-2-hydroxy-2,4-dimethylcyclopentyl]ethenoxy]-N,N,N',N'-tetramethylbutanediamide |
|---|---|
| PubChem CID | 102068734 |
| Molecular Formula | C17H30N2O5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (2R,3R)-2-hydroxy-3-[(E)-2-[(1S,2S,4S)-2-hydroxy-2,4-dimethylcyclopentyl]ethenoxy]-N,N,N',N'-tetramethylbutanediamide |
| SMILES | C[C@H]1C[C@@H](/C=C/O[C@@H](C(=O)N(C)C)[C@@H](O)C(=O)N(C)C)[C@@](C)(O)C1 |
| InChI | InChI=1S/C17H30N2O5/c1-11-9-12(17(2,23)10-11)7-8-24-14(16(22)19(5)6)13(20)15(21)18(3)4/h7-8,11-14,20,23H,9-10H2,1-6H3/b8-7+/t11-,12+,13+,14+,17-/m0/s1 |
| InChIKey | LWTZFZKDFPFUSW-MOSVCELLSA-N |
| XLogP | 0.22 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|