C16H34NO3P — CID 102070234
(tert-butylamino)methyl-[(5-methyl-2-propan-2-ylcyclohexyl)methoxy]phosphinic acid (PubChem CID 102070234) has the molecular formula C16H34NO3P and a molecular weight of 319.43 g/mol. Its IUPAC name is (tert-butylamino)methyl-[(5-methyl-2-propan-2-ylcyclohexyl)methoxy]phosphinic acid.
| Compound Name | (tert-butylamino)methyl-[(5-methyl-2-propan-2-ylcyclohexyl)methoxy]phosphinic acid |
|---|---|
| PubChem CID | 102070234 |
| Molecular Formula | C16H34NO3P |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (tert-butylamino)methyl-[(5-methyl-2-propan-2-ylcyclohexyl)methoxy]phosphinic acid |
| SMILES | CC1CCC(C(C)C)C(COP(=O)(O)CNC(C)(C)C)C1 |
| InChI | InChI=1S/C16H34NO3P/c1-12(2)15-8-7-13(3)9-14(15)10-20-21(18,19)11-17-16(4,5)6/h12-15,17H,7-11H2,1-6H3,(H,18,19) |
| InChIKey | VNWAHIMSURFIGM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|